Determine whether the given triangles are congruent

Determine Whether The Given Triangles Are Congruent

Answers

Answer 1

Answer:

Yes they are congruent and it is explained below

Step-by-step explanation:

There are 5 postulates when testing for congruency and they are;

SSS, SAS, ASA, AAS and HL.

S represents side

A represents angle

H represents hypotenuse

L represents leg

Now, in this our question, we can see that the 3 angles and the three sides of both triangles are equal to each other.

Thus, we can make use of SSS postulate whereby we say the 3 sides of the first triangle are equal to the 3 sides of the second triangle.

Thus, they are congruent.


Related Questions

PLEASE HELP! Enter answer/code

* show me how you got it and no random answers*

Answers

Answer:

a+b

Step-by-step explanation:

you have to multiply

7(3a-2b)                  5(3b-4a)

7x3=21                     5x3=15

7x2=14                      5x4=20

(21a-14b)                   (15b-20a)

add them

21a-14b+15b-20a

21a-20a=1a

-14b+15b=1b

1a+1b

maths help pls.......​

Answers

Answer: (C) 308 cm^2

Step-by-step explanation: Flat surface area is the surface area that is not curved; in this case, it would be the two circular bases. The height is arbitrary as the height is not needed to calculate the area of the bases. The formula for the area of circular bases is πr^2. Let's plug the given values into the formula. (22/7)(7)^2=(22/7)(49)=154. 154 cm^2 is the area of one base. To find the area of both bases, simply multiply the area of one base by two. 154*2 is 308, therefore the answer is (C) 308 cm^2.

if a man spends 70% of his income what percent does he save​

Answers

Answer:

30%

Step-by-step explanation:

Let's say he has 100% income

Spends 70%

Remaining=100-70=30%

Step-by-step explanation:

total percentage = 100%

total percentage spend = 70%

remaining percentage = 100% — 70% = 30%

882.3529411764706 to the nearest whole number

Answers

Answer:

882

Step-by-step explanation:

If it's over .5 you round up, if It's .4 or under you round down.

5.5 rounded to the nearest whole number is 6.

5.4 rounded to the nearest wholee number is 5.

Ahmad said that the volume of cone A is half the volume of cone B? Do you agree? Explain

Answers

Answer:

Yes, I agree

Step-by-step explanation:

See attachments for cone

Cone A

[tex]h = 2r[/tex]

Cone B

R = 2r

[tex]h=r[/tex]

The volume of a cone is

[tex]V = \frac{1}{3}\pi r^2h[/tex]

For cone A, we have:

[tex]V = \frac{1}{3}\pi r^2*2r[/tex]

[tex]V_A = \frac{2}{3}\pi r^3[/tex]

For cone B, we have:

[tex]V = \frac{1}{3}\pi *(2r)^2 * r[/tex]

[tex]V = \frac{1}{3}\pi *4r^2 * r[/tex]

[tex]V_B = \frac{4}{3}\pi r^3[/tex]

So, we have:

[tex]V_B = 2 * \frac{2}{3}\pi r^3[/tex]

Substitute [tex]V_A = \frac{2}{3}\pi r^3[/tex]

[tex]V_B = 2 * V_A[/tex]

Make VA the subject

[tex]V_A = \frac{1}{2}V_B[/tex]

Hence, I agree with Ahmad

The adjacent figure HOPE is a parallelogram. Find the angle measures x, y and z. State the properties you use to find them.​

Answers

Answer:

y=40°

Z + Y = 70°

z. = 70°-40°

z. = 30°

POH=X

=180-70

=110°

For what values of x is the expression below defined?
x +3 + x1 - x
O A. 35xs1
O B. 3 > XS-1
O C. 3 >x>1
O D. -3 sx< 1

Answers

Answer:

D. - 3 ≤ x < 1

Step-by-step explanation:

The numerator cannot be the square root of a neg. no.

So, x + 3 ≥ 0 or x ≥ -3

The denominator cannot be a neg. no. or 0.

So, 1 - x > 0

1 > x or x < 1

So, altogether - 3 ≤ x < 1

Therefore, D is the correct answer.

HOPE IT MAY HELP YOU

PLEASE MARK AS BRAINLIST

Please help !!!!!!!!

Answers

Answer:

table:

x = -2 , y = 5

x = 0 , y = -3

x = 1 , y = -4

x = 3, y = 0

b

i. line A

ii. y = -1,5

iii. x = -1.25

Step-by-step explanation:

as from the table

Step-by-step explanation:

the last one takes allot of steps but I tried those

Which statement are true of functions? (All that applies)
A. All function have a dependent variable
B. All function have a independent variable
C. The range of a function includes its domain
D. A vertical line is an example of a functional relationship
E. A horizontal line is an example of a functional relationship
F. Each output value of a function can correspond to only one input value

Answers

A and B and E.And sorry if I get it wrong.

A circular cardboard piece is needed for the base of a volcano model. The volcano is 46 centimeters tall and has a volume of 800 cubic centimeters. Which equation can be used to find the area of the circular base? 46 = one-third (B) squared (800) 46 = one-third (B) (800) 800 = one-third (B squared) (46) 800 = one-third (B) (46)

Answers

Answer:

800 = 1/3(B)(46)

Step-by-step explanation:

Volume of a cone is [tex]1/3pir^2h[/tex]

we can set up an equation where V = 1/3pir^2h

Knowns :

V = 800

h = 46

Plug the knowns into the equation

800 = 1/3(pir^2)(46)

pir^2 is the area of a circle, which in this case is B

hope this helps

The equation which can be used  to find the area of the circular base is 800 = 1/3(πr²)(46)

What is Three dimensional shape?

a three dimensional shape can be defined as a solid figure or an object or shape that has three dimensions—length, width, and height.

Given that  circular cardboard piece is needed for the base of a volcano model.

The volcano is 46 centimeters tall and has a volume of 800 cubic centimeters.

We have to find the equation which can be used to find the area of the circular base.

Volume of a cone is 1/3πr²h

V= 1/3πr²h

Plug in the values of volume and height in the above formula

V = 800

h = 46

800 = 1/3(πr²)(46)

Hence, the equation which can be used  to find the area of the circular base is 800 = 1/3(πr²)(46)

To learn more on Three dimensional figure click:

https://brainly.com/question/2400003

#SPJ7

Which of the following statements is true?

A. All trapezoids are parallelograms.
B. All rectangles are rhombuses.
C. All rhombuses are rectangles.
D. All squares are parallelograms.

Answers

Answer:

D. All squares are parallelograms. (Correct)

What are the coordinates of R on segments QS such that the ratio is 1:2. Q(-6,2) S(5,6)

Answers

Given:

The endpoints of a line segment QS are Q(-6,2) and S(5,6).

Point R divides the line segment QS in 1:2.

To find:

The coordinates of point R.

Solution:

Section formula: If a point divides a line segment in m:n, then the coordinates of that point are:

[tex]Point=\left(\dfrac{mx_2+nx_1}{m+n},\dfrac{my_2+ny_1}{m+n}\right)[/tex]

It is given that the endpoints of a line segment QS are Q(-6,2), S(5,6) and point R divides the line segment QS in 1:2. So, the coordinate of point R are:

[tex]R=\left(\dfrac{1(5)+2(-6)}{1+2},\dfrac{1(6)+2(2)}{1+2}\right)[/tex]

[tex]R=\left(\dfrac{5-12}{3},\dfrac{6+4}{3}\right)[/tex]

[tex]R=\left(\dfrac{-7}{3},\dfrac{10}{3}\right)[/tex]

Therefore, the coordinates of point R are [tex]\left(\dfrac{-7}{3},\dfrac{10}{3}\right)[/tex].

This is due for Tuesday please help.

Answers

Answer:

n=0.05

0.00036km

Step-by-step explanation:

a)

20:1

1:0.05

n=0.05

b)

1:25000

0.00036:9

0.00036km

PLEASE HELP. (Will Mark Brainliest)

Answers

Answer:

Step-by-step explanation:

17/60 = 0.2833333333.....  3 repeating

25/60 = .025  terminating

31/44 = 0.7045454545.....   45 repeating

54/72 = 0.75    terminating

Solve x- 7.5 = 4.1 for x.​

Answers

Answer: x = 11.6

Step-by-step explanation: 11.6 - 7.5 = 4.1

Please help me!! Perimeter: about ______ ft squared
Area: about ________ ft squared

Answers

Answer:

55.1 ft ; 236.7 ft^2

Step-by-step explanation:

radius = 7.5 ft

Perimeter of the semicircles = 2 * radius * pi = 2 * 7.5 * pi = 47,12389 ft

Perimeter of the rectangle = 4 * 2 = 8 ft

Total perimeter = 55,12389 ft

Area of the semicircles = radius^2 * pi = 7.5^2 * pi = 176,714587 ft^2

Area of the rectangle = 4 * 15 = 60 ft^2

Total area = 236,714587 ft^2

An archery video game has an auto-aim feature.
An archer wants to hit point T but his bow is aimed at point A, which is 15 m away from T as shown. The
auto-aim feature also knows that the archer is 60 m away from T and 50 m away from A
How many degrees will the auto-aim feature adjust the shot?
Do not round during your calculations. Round your final answer to the nearest degree

Answers

Answer:12

Step-by-step explanation:

Based on the calculations, the number of degrees that the auto-aim feature would adjust the shot is 12°.

How to calculate the angle formed?

Based on the triangle attached in the image above, we can deduce the following parameters:

Side AT = 15 m.

Side CA = 50 m.

Side CT = 60 m.

In this scenario, we would apply the cosine trigonometry function by using this mathematical expression:

AT² = CA² + CT² - 2(CA)(CT)COSθ

15² = 50² + 60² - 2(50)(60)COSθ

225 = 2500 + 3600 - 6000COSθ

6000COSθ = 6100 - 225

6000COSθ = 5875

θ = COS⁻¹(5875/6000)

θ = COS⁻¹0.9792

θ = 11.72 12°

Read more on cosine function here: https://brainly.com/question/4599903

#SPJ2

HELP THIS IS MY LAST ASSIGNMENT FOR MATH

Answers

Answer:

Decompose each number:

\begin{gathered}6) 90 = 9 \times 10\\\\7) 40 = 4 \times 10\\\\8)890 = 89 \times 10\\\\9) 300 = 3 \times 100\\\\10) 7000 = 7 \times 1000\\\\11)3700 = 37 \times 100\\\\\end{gathered}

6)90=9×10

7)40=4×10

8)890=89×10

9)300=3×100

10)7000=7×1000

11)3700=37×100

Correct the error. Write the correct decomposition:

\begin{gathered}12) 560 = 56 \times 10\\\\13) 4300 = 43 \times 100\\\\14) 6000 = 60 \times 100 \ \ or \ \ 6 \times 1000\end{gathered}

12)560=56×10

13)4300=43×100

14)6000=60×100 or 6×1000

In ΔMNO, m∠M = 57° and m∠N = 75°. Which list has the sides of ΔMNO in order from shortest to longest?

Answers

Answer:

B. MN, NO, OM

Step-by-step explanation:

Recall: In any triangle, the sides and the angles are related in the following way:

*The largest angle and the longest side are opposite each other

*The medium angle and the mid-sized side are opposite each other

*The smallest angle and the shortest side are opposite each other

In ∆MNO, we are given that

m<M = 57° which is opposite to side NO

m<N = 75° which is opposite to side OM

m<O = 180° - (75° + 57°) (sum of triangle)

m<O = 48° which is opposite to side MN

Therefore, we can write the order of shortest to longest side in relation to their opposite angles as follows:

MN, NO, OM

i need help again u guys

Answers

Answer:

x = -3

Step-by-step explanation:

X = -b/2a

X= -(-12)/2(-2)= -3

X= -3

I hope this answers your question and can u please brainliest my answer I would really appreciate it?!

The black graph is the graph of y= f(x). Choose the equation for the red graph
which one: a, b, c, d?

Answers

Answer:

Option C.

Step-by-step explanation:

First, let's define the transformations used here:

We can see that the red graph is shifted horizontally to the right, and that is reflected across the x-axis:

Horizontal shift:

For a general function f(x) an horizontal shift of N units is written as:

g(x) = f(x + N)

where:

If N > 0, the shift is to the left

if N < 0 , the shift is to the right.

Reflection across the x-axis.

For a function f(x), a reflection across the x-axis is just written as:

g(x) = -f(x)

So, if here we have a reflection across the x-axis and a horizontal shift of one unit to the right, we would write the equation for the red graph as:

g(x) = -f(x)     (only for the reflection)

g(x) = -f(x - 1)    (for the reflection and the shift)

Then the graph of the red function is:

y = -f(x - 1)

We can rewrite this as:

y = -1*f(x - 1)

dividing both sides by -1 we get:

y/-1 = f(x - 1)

This is what we can see in option C, so the correct option is C.

Which of the following statements are true?

Answers

Answer:

I am not 100% sure but like 75 % sure its A,c , and e

Step-by-step explanation:

Answer please ill apprciate it

Answers

Answer:

is B. 75

Step-by-step explanation:

x+26=101

x=101-26

:. x=75

[tex]\huge\boxed{\fcolorbox{lime}{yellow}{ B. \:75}}[/tex]

[tex]\sf \bf {\boxed {\mathbb {STEP-BY-STEP\:\:EXPLANATION:}}}[/tex]

[tex]x + 26 = 101[/tex]

[tex]➺ \: x = 101 - 26[/tex]

[tex]➺ \: x = 75[/tex]

Therefore, the value of [tex]x[/tex] is 75.

[tex]\sf \bf {\boxed {\mathbb {TO\:VERIFY :}}}[/tex]

[tex]➺ \: x + 26 = 101[/tex]

[tex]➺ \: 75 + 26 = 101[/tex]

[tex]➺ \: 101 = 101[/tex]

➺ L. H. S. = R. H. S.

Hence verified.

[tex]\large\mathfrak{{\pmb{\underline{\orange{Mystique35 }}{\orange{❦}}}}}[/tex]

Name the marked angle in 2 different ways.

Answers

1) angle DCB

2) angle BCD

Help and explain pls and thankyouuuuuu

Answers

Answer:

shhsksbsvsvdbdhsbs. c

9514 1404 393

Answer:

  (d)  -3

Step-by-step explanation:

Put the number into the expression and do the arithmetic.

  f(g(-2)) = f(-2-3) = f(-5) = 2(-5) +7 = -10 +7

  f(g(-2)) = -3

Debbie has 12 blooms on her lemon tree on the first day she thinks to check it. Each day after that, she notices 3 additional blooms. How many blooms does she have after one week?

Answers

Answer:

33 blooms

Step-by-step explanation:

This can be set up by an equation. x represents the number of days and y represents the number of corresponding blooms. y = 3x + 12 is the equation, as 3 is the rate of change and 12 is the initial amount. One week is 7 days, so 7 can be plugged in for x. 21 + 12 = 33, so after one week, Debbie has 33 blooms.

Here's a little something that will tease your brain. I doubt someone will answer this​

Answers

Answer:

500ml orange juice is the most cost effective

500 ml is the answer

Write an absolute value function that shifted 2
units right.

HELPPPP

Answers

Answer: (a)

Step-by-step explanation:

Suppose the original function is [tex]y=\left | x \right |[/tex]

To shift it 2 units right, replace x by x-2 such that

[tex]\Rightarrow x-2=0\\\Rightarrow x=2[/tex]

So, the function becomes [tex]y=\left | x -2\right |[/tex]

A bag contains 9 red, 6 green, 3 blue, and 2 yellow balls of the same size. A student chooses a colour and then draws a ball from the bag. If she draws a ball of her choice of colour she wins, if not the teacher wins. Who do you think will be the winner after 24 rounds, the student or the teacher

Answers

Answer:

the teacher will win becasue there are less numbers of colors to choose from one of the catagories then there are in total.

Step-by-step explanation:

no links please, i cant find the answer for q b) ii)

Answers

Answer:

-k

Step-by-step explanation:

Cos(140)=cos(180-40)=-cos(40)=-k

Answer:

Step-by-step explanation:

Sin (90 - A)  = Cos A

Cos (90 + A) =   -Sin A

Sin 50 = Sin (90 - 40)

          = Cos 40

         = k

Cos 140 = Cos (90 + 50)

             = - Sin 50

            = (- k)

Other Questions
What is the last phase of the website development process?O A. developmentOB.maintenanceO c. testingOD. design Find the mean of the data summarized in the given frequency distribution. Compare the computed mean to the actual mean of 47.3 miles per hour.Speed (miles per hour) 42-45 46-49 50-53 54-57 58-61Frequency 21 15 6 4 2The mean of the frequency distribution miles ______ per hour. (Round to the nearest tenth as needed.)Which of the following best describes the relationship between the computed mean and the actual mean?A. The computed mean is not close to the actual mean because the difference between the means is more than 5%.B. The computed mean is not close to the actual mean because the difference between the means is more than 5%.C. The computed mean is not close to the actual mean because the difference between the means is less than 5%.D. The computed mean is close to the actual mean because the difference between the means is less than 5%. Which of these was true about north american colonies held by britian and france before the french and indian war Mandolin produced 70,000 units and sold 50,000 units. Their unit selling price is $20 and they have variable unit production costs of $10, variable selling expenses of $3 and fixed overhead of $10,000. Compute Mandolin's net income under variable costing. Multiple choice question. $340,000 $350,000 $450,000 $500,000 please help me please help me please help me please help me please help me please help me please a number added to 3 is equal to negative 5, find the number QUESTION 33.1 The diagram below shows a cholera bacterium. It has been magnified 50 000timesA1 mm - 1000um3.1.1 Name structure C.(1)3.1.2 State the function of structure C.3.1.3 Calculate the actual width of the cholera bacterium between points Xand Y. Give your answer in micrometers (um). Show all working(2) Which view is consistent with the family-systems perspective?Select one:a. A person's behavior in a family is tied to the behavior of all the otherfamily members.b. Therapy cannot be attempted unless it is possible to treat everyone inthe family.c. Dysfunctional families are usually caused by a single family member.d. Families will always support a family member who makes a change toimprove themselves. The points A(-3, -4) and B(5, 0) form a line segment. Find the coordinates of the point P that partitions segment AB in a 2:3 ratio. Saw a board 5 ft 1 in. Long into six equal pieces. If the loss per cut is 1/5 in., how long will each piece be? Hubert is a stay-at-home parent who lives in New York City and teaches tennis lessons for extra cash. At a wage of $35 per hour, he is willing to teach 4 hours per week. At $45 per hour, he is willing to teach 8 hours per week. Using the midpoint method, the elasticity of Jakes labor supply between the wages of $50 and $65 per hour is approximately ___ , which means that Jakes supply of labor over this wage range is ___ . Point Z has the coordinates (3,5) and is translated left 2 units and down 2 units to create point Z.What are the coordinates of point Z? A factory employs 200 men and 50 women. 80 of the men are each paid $100, the rest are paid $80 and the women are paid $50, what is the total wage bill. You are participating in a Spanish summer camp students from all over the world are attending it's lunchtime and one of the students approaches you The diagram below is divided into equal parts. Which shows the ratio of unshaded section to shaded sections Rpondez aux questions suivantes : (5 aux choix) a. Quelles sont les responsabilits dune secrtaire ? b. Quelles sont les formalits pour avoir une carte de lecture ? c. Nommez la plus ancienne universit de Paris. d. Nommez deux peintres franais. e. Quelles sont les diffrentes rubriques dun journal ? f. Qui est R.K Narayan ? g. Quest-ce quun conte ? 5 pointsWhat is the process by which all the rock formations of a region arePUSHED UP due to plate motion? A solid right pyramid has a regular hexagonal base with an area of 5.2 cm2 and a height of h cm.A solid right pyramid has a regular hexagonal base with an area of 5.2 centimeters squared and a height of h centimeters.Which expression represents the volume of the pyramid?One-fifth(5.2)h cm3StartFraction 1 Over 5 h EndFraction(5.2)h cm3One-third(5.2)h cm3StartFraction 1 Over 3 h EndFraction(5.2)h cm3 3. A pair of sneakers that costs $60.50 is on sale for 20% off. Find the DISCOUNT. (5 Points) $20 O $12.01 $12.10 $48.40 Add the following numbers. -6 + 5 =