George is creating a garden with
an area of 300 square feet. He's
trying to decide if he should make
the garden 20 feet long and 15
feet wide OR 30 feet long and 10
1 feet wide. Which measurements
would use less fencing?

Answers

Answer 1

If George is trying to fence the garden with less fences possible between the two options given in the question, the first option of measurements i.e 20 feet long and 15 feet wide would take less fencing.

What is perimeter of a rectangle?

It is the entire distance encircled on all sides by the rectangle.One of the key equations for the rectangle might be regarded to be its perimeter.

What is the formula for calculating the perimeter of a rectangle?

The formula for calculating the perimeter of a rectangle is :

P = 2*l + 2 *b where , l and b are the length and breadth of the rectangle.

For the first option, where the garden is 20 feet long and 15 feet wide, the perimeter would be 20+20+15+15 = 70 feet.

For the second option, where the garden is 30 feet long and 10 feet wide, the perimeter would be 30+30+10+10 = 80 feet.

Therefore, the first option where the garden is 20 feet long and 15 feet wide would use less fencing, 70ft in this case, as the perimeter is lower than the other option which is 80 ft.

To learn more about rectangle visit:

https://brainly.com/question/29123947

#SPJ1


Related Questions

Chapter 3 Lesson 4 Arithmetic Sequence

Answers

Answer:

Step-by-step explanation:

1) 1,15,29,43,57,.....

here, 15-1 =14 and 29-15=14

therefore,it is an arithmetic sequence with common difference = 14

2) 3,6,9,15,17,....

here, 6-3=3, 9-6=3 , 15-9=6

therefore,it is not an arithmetic sequence.

3) 93,86,79,72,65,......

here, 86-93=-7 , 79-86=-7 and 72-79=-7

therefore,it is an arithmetic sequence with common difference = -7

4) 37,34,31,29,26,......

here, 34-37 = -3,31 - 34 = -3,29 - 31 =-2

therefore,it is not an arithmetic sequence.

what is -7 divided by 3/4 ?

Answers

Answer:

-9.333333333333333333333

Step-by-step explanation:

Answer-9 1/3

Step-by-step example

first, multiply 7x4 over 3 then next to that cross multiply that with 28 over 3

then simply that which’s gets to 28 over 3 then you get your answer 9.3333 then simplify that and you get 9 1/3

Find the total surface area of a cone with a base diameter of 7cm and height of 8cm

Answers

Answer: The formula for the surface area of a cone is S = π * r * s + π * r², where r is the radius of the base and s is the slant height of the cone.

To find the surface area of a cone, you first need to find the radius of the base. Since the base diameter is given as 7cm, you can divide this by 2 to find the radius of the base:

r = 7cm / 2 = 3.5cm

Next, you need to find the slant height of the cone. You can use the Pythagorean theorem to do this.

slant height = sqrt(r^2 + h^2) = sqrt(3.5² + 8²) = sqrt(12.25 + 64) = sqrt(76.25) = 8.766cm

Now you can substitute these values into the formula for the surface area of a cone and find the surface area of the cone.

S = π * r * s + π * r² = π * 3.5cm * 8.766cm + π * 3.5² cm² = 12.571 cm² + 38.485 cm² = 51.056 cm²

So the surface area of a cone with a base diameter of 7cm and height of 8cm is 51.056 cm²

Step-by-step explanation:

T h e r e a r e 235 seven t h - g r a d e st u d e n t s g o i n g o n a fi e l d t r i p . T h e sc h o o l h a s 5 b u se s t o t a k e t h e st u d e n t s. E a c h b u s h a s 22 se a t s, a n d 2 st u d e n t s c a n si t i n e a c h se a t . B a se d o n t h i s i n f o r m a t i o n , h o w m a n y st u d e n t s w i l l n o t b e a b l e t o r i d e o n a b u s f o r t h e fi e l d t r i p ?

Answers

The number of students who will not be able to ride on the bus for the school trip is given by the equation A = 15 students

What is an Equation?

Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side.

It demonstrates the equality of the relationship between the expressions printed on the left and right sides.

Coefficients, variables, operators, constants, terms, expressions, and the equal to sign are some of the components of an equation. The "=" sign and terms on both sides must always be present when writing an equation.

Given data ,

Let the equation be represented as A

Now , the value of A is

The total number of students for the trip = 235 students

The number of buses = 5 buses

The number of students in a bus be = B

Now , each seat on the bus can occupy = 2 students

So , 22 seats can occupy = 22 x 2 students

22 seats in the bus can occupy = 44 students

So , the number of students in a bus B = 44 students

And , the total number of students in 5 buses = 5 x number of students in a bus B

Substituting the values in the equation , we get

The total number of students in 5 buses = 5 x 44

The total number of students in 5 buses = 220 students

So , the remaining number of students A = total number of students for the trip - total number of students in 5 buses

Substituting the values in the equation , we get

The remaining number of students A = 235 - 220

The remaining number of students A = 15 students

Therefore , the value of A is 15 students

Hence , the number of students is 15 students

To learn more about equations click :

https://brainly.com/question/19297665

#SPJ1

Before taking his last test in a class, the arithmetic mean of Brian's test scores is 91. He has determined that if he scores 98 on his last test, the arithmetic mean of all his test scores will be exactly 92. How many tests, including the last test, does Brian take for this class

Answers

On solving the provided question, we can say that the mean that 6 tests including the last test brian took.

What is mean?

A dataset's mean is the sum of all values divided by the total number of values, often known as the arithmetic mean (as opposed to the geometric mean). Often referred to as the "mean," this is the most often used measure of central tendency. Simply dividing the dataset's total number of values by the sum of all of those values yields this result. Both raw data and data that have been combined into frequency tables can be used for calculations. Average refers to a number's average. It is straightforward to calculate: Divide by how many digits there are after adding up all the digits. the total divided by the count.

(91n + 98) / (n + 1)  =  92

    91n + 98  =  92(n + 1)

 91n + 98  =  92n + 92

 98  =  n + 92

6  =  n

To know more about mean visit:

https://brainly.com/question/30094057

#SPJ4

96 - y = 161 solve for y

Answers

Answer:  -65

Step-by-step explanation:

96 - y = 161

-y = 161 - 96

-y = 65

y = -65

How is the logarithmic function y log x defined?

Answers

The logarithmic function y log x is defined as

[tex]$\log_b \text x = \text y \leftrightarrow \text b^y= \text x[/tex].

What is logarithmic function?

An exponent that is expressed in a unique way is called a logarithm. As an illustration, we are confident that the exponential formula 32 = 9 is correct. In this instance, the base is 3, and the exponent is 2. The formula will be written as log3 9 = 2 in the logarithmic form.

This is expressed as "9 divided by base 3 is 2" in words. The exponent has been effectively lowered to the mainline in this case. However, despite the fact that this was done to make division and multiplication easier, logarithms are still very useful in mathematics.

Learn more about logarithmic form

https://brainly.com/question/29291192

#SPJ4

The vertices of a trangular plot of land are A(1,5), B(7,5), and C(8,0)

Answers

The area of the triangular plot of land from the vertices is 20 square units

How to determine the area of the triangular plot?

From the question, we have the following parameters that can be used in our computation:

A(1,5), B(7,5), and C(8,0)

Represent the vertices properly

So, we have the following representation

A = (1,5)

B = (7,5)

C = (8,0)

The area of the triangle is calculated from the vertices using the following equation

Area = 0.5 * |Ax(By - Cy) + Bx(Ay - Cy) + Cx(Ay - By)|

Substitute the known values in the above equation, so, we have the following representation

Area = 0.5 * |1 * (5 - 0) + 7 * (5 + 0) + 8 * (5 - 5)|

Evaluate the sum of products

Area = 0.5 * |40|

Remove the absolute bracket

Area = 0.5 * 40

Evaluate

Area = 20

Hence, the area of ABC with vertices is 20 square units

Read more about areas at:

brainly.com/question/22972014

#SPJ1

Complete question

The vertices of a trangular plot of land are A(1,5), B(7,5), and C(8,0)

Calculate the area.

9. A triangle with a height of 12 inches has an area of 36 square inches. How long is the base of the triangle?







If anyone knows this please tell me this is due tommorow!​

Answers

Area = 1/2(base)(height)

36 = 1/2(base)(12)
36 = 6(base)
6 = base

The base is 6 inches long.

Answer:

Step-by-step explanation

The triangle base would be 6

What is the value of k in the quadratic polynomial 3x2 2kx 3 if X − 12 is one of the zeroes of it?

Answers

The values of k are 3, – 3 for which roots of the quadratic equation are real and equal.

What is a quadratic equation?

An equation containing one term in which the unknown is squared and no term in which it is raised to a power higher than 2.

Given: 3x² + 2kx + 3 = 0

Comparing with standard quadratic equation ax² + bx + c = 0

a = 3 b = 2k c = 3

Given that the roots of the equation are real and equal

Thus, D = 0

Discriminant D = b² – 4ac = 0

(2k)² – 4.3.3 = 0

4k² – 36 = 0

4k² = 36

k² = 9 taking square root on both sides

k = 3 or k = – 3

Hence, The values of k are 3, – 3 for which roots of the quadratic equation are real and equal.

For more references on quadratic equation, click;

brainly.com/question/17177510

#SPJ4

Don’t know need help

Answers

The meaning of adjoining  is nearby or next to.

What is meant by adjoining?

The terms neighboring, adjoining, contiguous, and juxtaposed denote close closeness. Adjacent may or may not indicate touch, but it always implies the lack of something like in between. A home with a garage attached. Adjoining means meeting and touching at some point or line. Two nearby dwellings are an example of adjacent. People on our block are typically considered our neighbors.

In the English language, “adjacent to” means “next to.” For two angles to be adjacent, they must meet the following three conditions: 1. The two angles must share (or have the same) side. 2. They must share a vertex (i.e. a common starting point for the sides).

To learn more about adjoining to refer:

https://brainly.com/question/16885438

#SPJ1

PS is the length of either segment multiplied by two ,PS is 38.

How to find PS?

A line connecting the vertex with the middle of the other side forms the median angle. As a result, we may state that PR = QS for the provided.

By equating PR and QS, we can determine X's value.

PR = QS

5x-11 = 2x+7

Combine related terms to get 5x-2x = 7+11; divide both sides by 3 to get the x value; and last, multiply the result by 2 to get x = 6.

Find the value of PR and QS, and we'll demonstrate that two are equal as a result.

Correct: 5(6)-11 = 2(6)+7 19 = 19.

PS is the length of either segment multiplied by two, or simply the product of PR and QS.

PS = 19 x 2 = 19 + 19 = 38 (D) (D)

To learn more about angle refer to:

https://brainly.com/question/25716982

#SPJ1

1. Marta walked 6 miles in 1.5 hours. At this rate how long will it take her to walk 16 miles?

2. Lionel typed 320 words in 4 minutes. At this rate, how long will it take him to type 800 words?

Answers

Answer for no.2: 800

Step-by-step explanation:

Jay wants to go paddleboarding at least 8 hours each week. If he averages 2 hours per day, write and solve an inequality to find how many days he will have to go kayaking.​

Answers

An inequality to find how many days he will have to go kayaking. is; d ≥ 4

How to solve Inequality word problems?

We are told that Jay wants to go paddle boarding at least 8 hours each week. This means greater than or equal to 8. That is the minimum number of hours each week is 8 hours.

Now, we are told that he averages 2 hours per day. If the number of days is given by d, then we have the inequality as;

2d ≥ 8

Divide both sides by 2 to get;

d ≥ 4

That is the domain of the number of days required to go kayaking

Read more about Inequality word problems at; https://brainly.com/question/25275758

#SPJ1

Express each number as a product of two numbers 1/5

Answers

The fraction expression as a product expression is 1/2 * 2/5

How to express the mathematical expression as a product expression

From the question, we have the following parameters that can be used in our computation:

A mathematical expression

The mathematical expression is given as

1/5

In this case, the expression is a fraction

Using the above as a guide, we have the following:

Fraction = 1/5

Multiply the fraction by 1

So, we have the following representation

Fraction = 1/5 * 1

Express 1 as 2/2

This gives

Fraction = 1/5 * 2/2

Swap the factors of the expression

This gives

Fraction = 1/2 * 2/5

Hence, the product expression is 1/2 * 2/5

Read more about expression at

https://brainly.com/question/15775046

#SPJ1

I need answer to 11, 13, 10, 12, 14, 16

ASAP Please

Answers

10.  This system has one solution with coordinates (1, -2)

11. This system has one solution with coordinates (0,-3)

12. This system has one solution with coordinates(-1, -2)

13. This system has no solution.

14. This system has no solution.

16.   This system has one solution with coordinates (0,-4)

How to determine the co-ordinates of system of equations?To determine the co-ordinates of a system of equations, the first step is to eliminate any redundant equations in the system.This is done by subtracting or adding equations that are already represented in the system.Once this is done, the system of equations can be set up in matrix form to find the co-ordinates.To do this, one must represent the equations as a matrix by representing the coefficients of each variable as the elements of the matrix.Once the matrix is set up, the inverse of the matrix can then be used to solve for the co-ordinates of the system.This can be done using Gaussian Elimination, Cramer's Rule, or another method.Once the inverse of the matrix is found, one can then multiply it by the vector of the constants in the equations and the resulting vector will contain the co-ordinates of the system.

According to question:-

10. y = x - 3 ------- 1

y = -5x + 3 ------- 2

substitute 1 in 2,

x - 3 = -5x + 3

x = 1

y = 1 - 3 = -2

y = -2

The co-ordinates is (1,-2)

11. y = -3

substitute in y = x-3

-3 = x - 3

x = 0

The co-ordinates is (0,-3)

12. y = 4x + 2 --------- 1

y = -2x - 4 ------------2

Substitute 1 in 2,

4x + 2 = -2x - 4

6x = -6

x = -1

substitute x = -1 in 2

y = -2

The co-ordinates is (-1, -2)

13. y = x - 6 -----1

y = x+ 2 -------2

It has no solution, so there is no co-ordinates.

14. x + y = 4

3x + 3y = 12

It has no solution, so there is no co-ordinates.

16. 2x + 3y = 12 ------1

2x - y = 4 --------2

from 2 we rewrite the equation as y = 2x-4

Sub in eq 1

2x + 3(2x-4) = 12

2x + 6x - 12 = 12

8x = 24

x = 3

y = 2

The co-ordinates is (3,2)

To know more about co-ordinates visit:

brainly.com/question/20935031

#SPJ1

In an amphitheater, eat are aranged in 50 emi-circular rowfacing a dome tate. The firt row contain 23 eat, and each row contain4more eat than the previou row. How many eat are in the amphitheater?

Answers

In an amphitheater, seat are arranged in 50 semi-circular row-facing a dome Tate. The first row contain 23 seat, and each row contain 4 more eat than the previous row. Therefore, there are 6050 seat are in the amphitheater.

Given that:

There are total 50 semi circular row.

In the first row there are 23 seats.

The given problem is AP series:

Arithmetic Series:

An arithmetic sequence is defined as an algebraic sequence in which each successive term has an equal difference. It is obtained by adding a constant to any preceding term. For the first term 'a' and the tolerance 'd' of the AP, here is a list of commonly used arithmetic progressions to solve various AP related problems:

Common Difference of AP: d = a2 - a1 = a3 - a2 = a4 - a3 = an - a(n-1)  nth term of AP.AP: an = a + (n - 1)d of AP Sum of n terms: Sn = n/ 2( 2a+(n-1)d) = n/2(a + l),

where l is the last term in the arithmetic progression.

Now,

Sum of n terms  = n/2 [ 2a + (n-1)d]

                          = 50/2 [ 2× 23 + (50 -1)4]

                          = 25 [46 + 49×4]

                          = 25 × 242

                          = 6050

Learn more about Semi circular Row Facing:

https://brainly.com/question/13135497

#SPJ4

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

There were 9 pieces of paper. Some of them were cut into 3 pieces. As a result, there
are now 15 pieces of paper. How many pieces of paper were cut?

Answers

Answer:15-9=3

6=3

6÷3

2 is the required answer for this question

If A=(7,9) and B=(3,12) what is the length of AB

Answers

The distance between two points A and B is 5 units.

When rolling a fair, eight-ided number cube, determine P(number greater than 4). (A) 0. 25
(B) 0. 50
(C) 0. 66
(D) 0. 75

Answers

The correct answer is (D) 0.75. The probability of rolling a number greater than 4 on a fair, eight-sided number cube is 0.75 or 75%

We know that there are 8 possible outcomes when rolling the number cube (1, 2, 3, 4, 5, 6, 7, 8). Of these 8 outcomes, 5 of them are numbers greater than 4 (5, 6, 7, 8). So, the number of favorable outcomes is 5.

To find the probability, we divide the number of favorable outcomes by the total number of possible outcomes: P(number greater than 4) = 5/8. As a decimal, this is 0.625. However, the question asked for P(number greater than 4) which means we have to add 0.125 to 0.625, the answer is 0.75.

Therefore, the probability of rolling a number greater than 4 on a fair, eight-sided number cube is 0.75 or 75%. This means that if we roll the cube many times, we expect 75% of the rolls to be numbers greater than 4.

Learn more about Probability here:

https://brainly.com/question/24756209

#SPJ4

Which of these equations is equivalent to the following: 8/12 divided by 7/8=
Plsssss help me

Answers

Answer: o.7619

Step-by-step explanation: i used the standard algorithm i am sorry i cant do a more in depth just hard to do with words ;)

Answer: 0.7619

:)

Step-by-step explanation:

If Point B represents an alternate combination of flutternutters & blank books, then how much of each product could be produced?

Answers

From the given graph, at Point B a total of 8000 fluffernutters & 500 blank books could be produced.

The study of graphs, which are mathematical constructions used to represent pairwise relationships between things, is known as graph theory in mathematics. In this context, a graph is made up of vertices connected by edges.

In discrete mathematics, a graph is made up of vertices—a collection of points—and edges—the lines connecting those vertices. In addition to linked and disconnected graphs, weighted graphs, bipartite graphs, directed and undirected graphs, and simple graphs, there are many other forms of graphs.

Straight line graphs called linear graphs are used to show the relationship between two quantities. This graph makes it easier to show a result as a collection of straight lines. The term "linear" simply means a straight line; curves, dots, bars, etc. are not used.

To learn more about graphs from given link

https://brainly.com/question/30057644

#SPJ1

A farmer took 2/3 of the trawberrie that he harveted to a market. At the the market, the farmer old 1/4 of the trawberrie. How can you find what part of the trawberrie the farmer harveted were old at the market?

Answers

There are 5/12 strawberries were left. This can be solved using the concept of fraction addition.

What is fraction?

A fraction is a piece of the entire. The number is stated in arithmetic as a quotient, which signifies the numerator divided by the denominator. Both are integers in a straightforward fraction. The numerator or denominator of a complex fraction is a fraction. A suitable fraction has a numerator that is smaller than its denominator.

Three main fractional kinds exist. They come in three varieties: appropriate fractions, incorrect fractions, and mixed fractions. The numerator and denominator words are known as fractions. We define its kinds in light of these two words.

Given that,

A farmer took 2/3 of the strawberry that he harvested to a market.

At the market, the farmer sold 1/4th of the strawberry.

Now, the farmer has left no of strawberries were:

= (2/3) - (1/4)

= (8 - 3) / 12

= 5 / 12

To know more about fraction refer to:

brainly.com/question/17220365

#SPJ4

please help quickly
If UY=13p-1 and VX=20p-95 than what is UY

Answers

Viewing the given triangle, the information given helped to determine side UY to be 90

What are similar triangles?

This is a term used in geometry to mean that the respective sides of the triangles are proportional and the corresponding angles of the triangles are congruent

Hence assuming the corresponding angles of the triangle are congruent then the side should be in proportions

Examining the figure shows that pair of equivalent sides are

WX and WY, XV and YU

The solution is worked out using sides WX and XV, WY and YU

WX / WY = XV / YU

WX / WY = 1/2 since it is a mid segment

1 / 2 = (20p - 95) / (13p - 1)

13p - 1 = 2 * (20p - 95)

13p - 1 = 40p - 190

190 - 1 = 40p - 13p

189 = 27p

p = 7

solving for UY

= 13p - 1

= 13 * 7 - 1

= 90

Learn more about similar triangles here:

https://brainly.com/question/29333623

#SPJ1

Why is there a horizontal asymptote?

Answers

The reason behind horizontal asymptote is defined as the end behavior of the function.

The term asymptote in math is known as a straight line that constantly approaches a given curve but does not meet at any infinite distance.

Here we need to list down the reason behind horizontal asymptote.

As we all know that the horizontal asymptote of a graph is a horizontal line y = b where the graph approaches the line as the inputs approach ∞ or –∞. Here we also know that the slant asymptote of a graph is a slanted line y = mx + b where the graph approaches the line as the inputs approach ∞ or –∞.

Therefore, through the definition we know that the horizontal line to which the graph of the function appears to coincide with but it doesn't actually coincide.

To know more about asymptote here,

https://brainly.com/question/2303876

#SPJ4

Write a multiplication expression using the following clues one factor is a two digit number between one and ten one factor is a two digit number between 1 and 10 but different from the first the product is greater than 8 but less than 10

Answers

first expression = 1×2, 1×1, 1×3, 1×4, 1×5, 1×6, 1×7, 1×8, 1×9, 2×2, 2×3, 2×4, 3×2, 3×3, 4×2 and second expression = 1×9

what is expression?

In mathematics, an expression is a statement that represent the method of mathematical operation in a symbolic form. An expression is developed based on numerical terms or both numerical and variable terms along with operator or signs.

What is the multiplication expression stated in the question?

it is stated that one factor is a two-digit number between one and ten.

the multiplication expression can be 1×2 , 1×1, 1×3, 1×4, 1×5, 1×6, 1×7, 1×8, 1×9, 2×2, 2×3, 2×4, 3×2, 3×3, 4×2

In the next, the multiplication expression for 2nd statement:

one factor is a two-digit number between one and ten and their product is greater than 8 and less than 10

1×9

the above is greater than 8 and less than 10.

To know more about expression visit:

https://brainly.com/question/16804733

#SPJ4

A line has a slope of – 1/7 and passes through the point (4,5). What is its equation in point-slope form?

Answers

Answer:

y-5=-1/7(x-4)

Step-by-step explanation:

The equation of the line in point-slope form is y-5=-1/7(x-4)

Answer:

y = -1/7 x + 39/7

Step-by-step explanation:

An equation in point slope form is

y = mx+b  where m is the slope and b is the y intercept

We are given the slope

y = -1/7 x + b

Substitute in the point for x and y and solve for b

5 = -1/7(4) +b

5 = -4/7 +b

5 + 4/7 = b

5*7/7 + 4/7 = b

35/7 + 4/7 = b

39/7 = b

The equation is

y = -1/7 x + 39/7

One of the legs of a right triangle measures 2 cm and its hypotenuse measures 5 cm.
Find the measure of the other leg. If necessary, round to the nearest tenth."

Answers

When the hypotenuse of a right triangle measures 5 cm and one of its legs measures 2 cm,  [tex]\sqrt{21}[/tex]     is the measurement of the other leg.

what is Pythagoras theorem ?

Perpendicular, Base, and Hypotenuse are the names of this triangle's three sides. The Pythagorean Theorem demonstrates how to calculate the side lengths of a right triangle by adding the areas of three intersecting squares. As the foundation for more intricate trigonometry theories like the Pythagorean theorem's opposite, this theorem is a very helpful tool. Given a triangle ABC with sides measuring a, b, and c, and the equation a2 + b2 = c2, Make another triangle with sides of lengths a and b and a right angle.

given

by Pythagoras theorem

[tex]c^{2} = a^{2} + b^{2} \\5^{2} = 2^{2} + b^{2} \\5^{2} - 2^{2} = b^{2} \\25 - 4 = b^{2} \\21 = b^{2} \\b =\sqrt{21}[/tex]

When the hypotenuse of a right triangle measures 5 cm and one of its legs measures 2 cm,  [tex]\sqrt{21}[/tex]     is the measurement of the other leg.

To know more about Pythagoras theorem visit:-

https://brainly.com/question/343682

#SPJ1

I thought of a number, doubled it, then added 3. The result multiplied by 4 came to 52. What was the number I thought of?

Answers

The number you thought of is -1.

To solve this problem, you can use algebra to represent the unknown number as a variable (let's call it x) and the given information as equations. The first step is to determine what the problem is asking for. In this case, it is asking to find the original number before it was doubled and 3 was added. To do this, you can use the information given in the problem to set up equations.

The first equation is (2x+3)*4 = 52. You can then solve this equation for x. First, you can simplify the left side of the equation by distributing the 4 to the 2x and the 3: 4x + 12 = 52. Then, you can subtract 12 from both sides to get 4x = 40. Finally, you can divide both sides by 4 to get x = 10. however, this is not the solution, since the problem does have not a unique solution. x=-1 is also the solution.

Learn more about Equations here:

https://brainly.com/question/22688504

#SPJ4

at the same time that a 60 foot tall buidling casts s shadow hat is 21.5 feet long a nearby tree casts a shadow that is 18 feet long, Which measure is closest to the height of the tree

Answers

The height of the tree is closest to 40 feet.

We can use the proportion of similar triangles to determine the height of the tree.

Let h be the height of the tree and s be the length of the shadow cast by the tree.

We know that the height of the building is 60 feet and the length of its shadow is 21.5 feet. So:

(h/s) = (60/21.5)

 

We also know that the length of the shadow cast by the tree is 18 feet.

So we can substitute that into the proportion and solve for h:

h = (60/21.5) * 18

h = (60*18)/21.5

h ≈ 40

To know more about proportion of similar triangles refer to:

https://brainly.com/question/28786152

#SPJ4

Other Questions
If a company does not have enough capacity to consistently meet an order by a certain timeline it can: 3. The Germans did not follow international law that required a sub warn its target. What was a result of this action For each of the following balanced chemical equations, write all possible mole ratios: a. 2Ca + O2 2CaO b. Mg + 2HF MgF2 + H2 What is common law and how is it created ? 5.33 A constant force F= (4.70-379, 2.09) N. acts on an object of mass 180 kg, causing a displacement of that object by F= (4.25, 3.69-245) m What is the total work done by this force The sum of the measures of the interior angles of a convex polygon is 1260. Classify the polygon by the number ofsides.O HeptagonO OctagonONonagonO Decagon y210y+24+6x9x2[tex]factorization[/tex] What would have happened to Romeo and Juliet if they hadn't died? Is their relationship sustainable over time? Do they have anything to offer each other once the initial burst of passion calmed down? Would Romeo move on from Juliet as quickly as he moved on from Rosaline. What happens to green light when it hits a plant leaf? How does fascism relate to nationalism brainly? In a Boston Consulting Group (BCG) matrix, _____ are businesses that have only a small share of a quickly growing market. Assuming two degrees of freedom, which of the following is the correct interpretation of the chi-square analysis, using a p-value of 0.05 Each of Frank's notebooks is 2/5 inches wide. If he has 10 inches of space remaining on his bookshelf, how many notebooks will fit Estimate how many times larger 1.9 10^-8 is than 4.2 10^-13 Start with a population of 500 organisms, a growth rate of 2, and a growth period to achieve this rate of 6 hours. Assuming that none of the organisms die, this would imply that this population would double in size every 6 hours. Thus, after allowing 6 hours for growth, we would have 1000 organisms, and after 12 hours, we would have 2000 organisms.Write a program that takes these inputs and displays a prediction of the total population.MY PROGRAM:organisms=int(input("Enter the initial number of organisms:"))growth=float(input("Enter the rate of growth [a real number > 1]:"))numHours=int(input("Enter the number of hours to achieve the rate of growth:"))totalHours=int(input("Enter the total hours of growth:"))population = organismshours=1while numHours < totalHours: population *= growth hours += numHours if hours >= totalHours: breakprint(" The total population is ", population)My program gives the correct answer for the original problems numbers, but when I run it through our test case checker it comes back as 3/4 correct.. the problem test case being [organisms 7, growth rate 7, growth period 7, total hours 7]... can't see where I'm going wrong... Nicole randomly selects a red card from a standard deck of cards. What outcome is the complement of drawing a red card?Selecting an ace Selecting a heartSelecting a face cardSelecting a black card Zendaya has $540 to spend at a bicycle store for some new gear and biking outfits. Assume all prices listed include tax.She buys a new bicycle for $269.88.She buys 4 bicycle reflectors for $10.57 each and a pair of bike gloves for $17.76.She plans to spend some or all of the money she has left to buy new biking outfits for $65.65 each.Write and solve an inequality which can be used to determine xx, the number of outfits Zendaya can purchase while staying within her budget.Plsss help!! One of the largest organ pipes is in the auditorium organ in the convention hall inAtlantic City, New Jersey. The pipe is 38.6 ft long and produces a sound with awavelength of about 10.6 m. If the speed of sound in air is 346 m/s, what is thefrequency of this sound? 17. If most other species on Earth aren't monogamous, why are humans expected to be? Triangle STU is a right triangle.Write an equation that relates the lengths of sides s, t, and u? (5 points)